Source: Wikipedia, the free encyclopedia.
Chemical compound
Octriptyline |
|
N-methyl-3-(11-tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaenylidene)propan-1-amine
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C20H21N |
---|
Molar mass | 275.395 g·mol−1 |
---|
3D model (JSmol) | |
---|
|
InChI=1S/C20H21N/c1-21-12-6-11-16-14-7-2-4-9-17(14)19-13-20(19)18-10-5-3-8-15(16)18/h2-5,7-11,19-21H,6,12-13H2,1H3 Key:MILRTYCRJIRPKY-UHFFFAOYSA-N
|
Octriptyline (SC-27,123) is a tricyclic antidepressant (TCA) that was never marketed.[1][2]
See also
References
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|